CymitQuimica logo

CAS 939757-89-8

:

1-(tert-Butoxycarbonyl)-4-phenylpyrrolidine-3-carboxylic acid

Description:
1-(tert-Butoxycarbonyl)-4-phenylpyrrolidine-3-carboxylic acid is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. The presence of a tert-butoxycarbonyl (Boc) group indicates that it is a protected amino acid, commonly used in peptide synthesis to temporarily mask the amine functionality. The phenyl group attached to the pyrrolidine ring contributes to the compound's hydrophobic characteristics and can influence its biological activity. This compound typically exhibits properties such as solubility in organic solvents and limited solubility in water, which is common for many organic compounds with large hydrophobic groups. Its carboxylic acid functional group allows for potential reactivity in various chemical reactions, including esterification and amidation. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to serve as a building block for more complex molecules. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if not managed properly.
Formula:C16H21NO4
InChI:InChI=1S/C16H21NO4/c1-16(2,3)21-15(20)17-9-12(13(10-17)14(18)19)11-7-5-4-6-8-11/h4-8,12-13H,9-10H2,1-3H3,(H,18,19)
InChI key:KEWYECRQALNJJM-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CC(C(C1)C(=O)O)C2=CC=CC=C2
Synonyms:
  • 4-Phenyl-1,3-pyrrolidinedicarboxylic acid 1-(tert-butyl) ester
Found 2 products.