CymitQuimica logo

CAS 939760-41-5

:

1,1-Dimethylethyl N-[2-amino-2-(2-bromophenyl)ethyl]carbamate

Description:
1,1-Dimethylethyl N-[2-amino-2-(2-bromophenyl)ethyl]carbamate, identified by its CAS number 939760-41-5, is a chemical compound characterized by its unique structure, which includes a carbamate functional group and a bromophenyl moiety. This compound typically exhibits properties associated with both amines and carbamates, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the amino and carbamate groups. The presence of the bromine atom in the aromatic ring may impart specific reactivity and influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the tert-butyl group (1,1-dimethylethyl) contributes to steric hindrance, which can affect the compound's interaction with biological targets. Overall, this compound may be explored for its potential applications in pharmaceuticals or agrochemicals, although specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C13H19BrN2O2
InChI:InChI=1S/C13H19BrN2O2/c1-13(2,3)18-12(17)16-8-11(15)9-6-4-5-7-10(9)14/h4-7,11H,8,15H2,1-3H3,(H,16,17)
InChI key:InChIKey=LSNWFWHKHZIBJO-UHFFFAOYSA-N
SMILES:C(CNC(OC(C)(C)C)=O)(N)C1=C(Br)C=CC=C1
Synonyms:
  • 1,1-Dimethylethyl N-[2-amino-2-(2-bromophenyl)ethyl]carbamate
  • Carbamic acid, N-[2-amino-2-(2-bromophenyl)ethyl]-, 1,1-dimethylethyl ester
Found 2 products.