CAS 94-64-4
:2-Chloro-N-methylbenzenemethanamine
Description:
2-Chloro-N-methylbenzenemethanamine, also known as 2-chloro-α-methylbenzeneethanamine, is an organic compound characterized by its amine functional group and a chloro substituent on the aromatic ring. It features a benzene ring with a methyl group and an amino group attached to the ethyl chain, which contributes to its reactivity and potential applications in organic synthesis. The presence of the chlorine atom introduces unique properties, such as increased polarity and the potential for nucleophilic substitution reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents and may exhibit moderate toxicity, necessitating careful handling. 2-Chloro-N-methylbenzenemethanamine is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential as an intermediate in the synthesis of more complex molecules. As with many amines, it may also participate in hydrogen bonding, influencing its physical properties and interactions with other chemical species.
Formula:C8H10ClN
InChI:InChI=1S/C8H10ClN/c1-10-6-7-4-2-3-5-8(7)9/h2-5,10H,6H2,1H3
InChI key:InChIKey=DIWGZVQKFSFNLH-UHFFFAOYSA-N
SMILES:C(NC)C1=C(Cl)C=CC=C1
Synonyms:- (2-Chloro-Benzyl)-Methyl-Amine
- (2-Chlorobenzyl)methylamine
- (2-chlorophenyl)-N-methylmethanamine
- (2-chlorophenyl)-N-methylmethanaminium
- 1-(2-Chlorophenyl)-N-methylmethanamine
- 2-Chloro-N-Methyl-Benzenemethanamin
- 2-Chloro-N-Methylbenzylamine
- 2-Chloro-N-methylbenzenemethanamine
- Akos Bc-2744
- Asinex-Reag Bas 16578945
- Benzenemethanamine, 2-chloro-N-methyl-
- Benzylamine, o-chloro-N-methyl-
- Methyl((2-chlorophenyl)methyl)amine
- N(O-Chlorobenzyl)Methylamine
- N-(2-Chlorobenzyl)-N-Methylamine
- N-2-Chlorobenzylmethylamine
- N-Ethyl-O-Chlorobenzylamine
- N-Methyl-2-chlorobenzylamine
- N-Methyl-o-chlorobenzylamine
- O-Chloro-N-Methylbenzylamine
- Timtec-Bb Sbb010370
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloro-N-methylbenzylamine
CAS:2-Chloro-N-methylbenzylamineFormula:C8H10ClNPurity:95%Molecular weight:155.63N-(2-Chlorobenzyl)-N-Methylamine
CAS:Formula:C8H10ClNPurity:95%Color and Shape:LiquidMolecular weight:155.62472-Chloro-N-methylbenzylamine
CAS:2-Chloro-N-methylbenzylamineFormula:C8H10ClNPurity:98%Color and Shape:LiquidMolecular weight:155.6247(2-Chloro-benzyl)-methyl-amine
CAS:Formula:C8H10ClNPurity:98%Color and Shape:LiquidMolecular weight:155.63N-(2-Chlorobenzyl)-n-methylamine
CAS:2-Chlorobenzyl-N-methylamine is a benzoxazole that has been shown to have antihypertensive activity. It is an oxidant and also has the ability to inhibit the oxidation of amines, which may be due to its efficient electron transfer. 2-Chlorobenzyl-N-methylamine can be used as an additive for animal feed, or as a chemical intermediate in the synthesis of benzylamine derivatives. In vitro studies show that it reduces blood pressure by inhibiting angiotensin II production and increasing vasodilation. This drug also inhibits phosphodiesterase activity, leading to increased levels of cAMP and suppression of the renin–angiotensin system.Formula:C8H10ClNPurity:Min. 95%Molecular weight:155.62 g/mol




