CymitQuimica logo

CAS 940002-59-5

:

β-D-Glucopyranuronic acid, 1-[N-[(1R)-3-[5,6-dihydro-3-(trifluoromethyl)-1,2,4-triazolo[4,3-a]pyrazin-7(8H)-yl]-3-oxo-1-[(2,4,5-trifluorophenyl)methyl]propyl]carbamate]

Description:
β-D-Glucopyranuronic acid, 1-[N-[(1R)-3-[5,6-dihydro-3-(trifluoromethyl)-1,2,4-triazolo[4,3-a]pyrazin-7(8H)-yl]-3-oxo-1-[(2,4,5-trifluorophenyl)methyl]propyl]carbamate] is a complex organic compound characterized by its structural features, which include a glucopyranuronic acid moiety and a carbamate functional group. The presence of the triazolo-pyrazine ring system contributes to its potential biological activity, possibly influencing its pharmacological properties. The trifluoromethyl and trifluorophenyl substituents suggest that the compound may exhibit unique electronic properties, enhancing its lipophilicity and potentially affecting its interaction with biological targets. This compound is likely to be soluble in polar solvents due to the glucopyranuronic acid component, while the presence of fluorinated groups may impart stability and alter its reactivity. Overall, the intricate structure of this compound indicates potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Further studies would be necessary to elucidate its specific biological activities and mechanisms of action.
Formula:C23H23F6N5O9
InChI:InChI=1S/C23H23F6N5O9/c24-10-6-12(26)11(25)4-8(10)3-9(30-22(41)43-20-17(38)15(36)16(37)18(42-20)19(39)40)5-14(35)33-1-2-34-13(7-33)31-32-21(34)23(27,28)29/h4,6,9,15-18,20,36-38H,1-3,5,7H2,(H,30,41)(H,39,40)/t9-,15+,16+,17-,18+,20+/m1/s1
InChI key:InChIKey=GKDZQUQEXZXGMZ-KUVPMCASSA-N
SMILES:C(F)(F)(F)C=1N2C(CN(C(C[C@@H](CC3=C(F)C=C(F)C(F)=C3)NC(O[C@@H]4O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]4O)=O)=O)CC2)=NN1
Synonyms:
  • β-D-Glucopyranuronic acid, 1-[N-[(1R)-3-[5,6-dihydro-3-(trifluoromethyl)-1,2,4-triazolo[4,3-a]pyrazin-7(8H)-yl]-3-oxo-1-[(2,4,5-trifluorophenyl)methyl]propyl]carbamate]
Found 7 products.