CymitQuimica logo

CAS 94010-78-3

:

Benzeneacetic acid, a,a,4-trifluoro-

Description:
Benzeneacetic acid, α,α,4-trifluoro- is an aromatic carboxylic acid characterized by the presence of a benzene ring attached to an acetic acid moiety, with three fluorine atoms substituted at the α and 4-position of the benzene ring. This compound typically exhibits a white crystalline solid form and is known for its relatively low solubility in water, while being more soluble in organic solvents. The trifluoromethyl groups contribute to its unique chemical properties, including increased lipophilicity and potential biological activity. The presence of fluorine atoms can enhance the compound's stability and reactivity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific interactions with biological targets due to the electronegative nature of fluorine, which can influence its pharmacokinetic and pharmacodynamic profiles. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C8H5F3O2
InChI:InChI=1S/C8H5F3O2/c9-6-3-1-5(2-4-6)8(10,11)7(12)13/h1-4H,(H,12,13)
InChI key:POBKFWBINPQWMW-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C(C(=O)O)(F)F)F
Synonyms:
  • 2,2-Difluoro-2-(4-fluorophenyl)acetic Acid
  • a,a,4-Trifluorobenzeneacetic Acid
Found 6 products.