CymitQuimica logo

CAS 940284-98-0

:

2-[4-(N-Boc)piperazin-1-yl]pyrimidine-5-boronic acid pinacol ester

Description:
2-[4-(N-Boc)piperazin-1-yl]pyrimidine-5-boronic acid pinacol ester is a chemical compound characterized by its boronic acid functionality, which is significant in various organic synthesis applications, particularly in Suzuki coupling reactions. The presence of the N-Boc (tert-butoxycarbonyl) protecting group on the piperazine moiety indicates that this compound can be utilized in peptide synthesis or as a building block in medicinal chemistry. The pyrimidine ring contributes to the compound's potential biological activity, as pyrimidines are often found in pharmaceuticals and agrochemicals. The pinacol ester formation enhances the stability and solubility of the boronic acid, making it more amenable for use in reactions. This compound is typically handled under controlled conditions due to its reactivity and potential for hydrolysis in the presence of moisture. Overall, its unique structural features make it a valuable intermediate in the synthesis of more complex organic molecules.
Formula:C19H31BN4O4
InChI:InChI=1S/C19H31BN4O4/c1-17(2,3)26-16(25)24-10-8-23(9-11-24)15-21-12-14(13-22-15)20-27-18(4,5)19(6,7)28-20/h12-13H,8-11H2,1-7H3
InChI key:YODSUBUWTUTLAZ-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)N3CCN(CC3)C(=O)OC(C)(C)C
Synonyms:
  • 2-(4-Boc-piperazino)pyrimidine-5-boronic acid pinacol ester
Found 6 products.