CAS 941296-80-6

Fmoc-N-Me-Asn(Trt)-OH

Description:

Fmoc-N-Me-Asn(Trt)-OH, with the CAS number 941296-80-6, is a protected amino acid derivative commonly used in peptide synthesis. The "Fmoc" (9-fluorenylmethoxycarbonyl) group serves as a protective group for the amino functionality, allowing for selective reactions during peptide assembly. The "N-Me" indicates that the amine group is methylated, which can influence the steric and electronic properties of the molecule. The "Asn" refers to asparagine, an amino acid that contains an amide side chain, contributing to the molecule's hydrophilicity and potential for hydrogen bonding. The "Trt" (trityl) group is a protective group for the side chain, providing stability and preventing unwanted reactions during synthesis. This compound is typically utilized in solid-phase peptide synthesis, where the protection and deprotection strategies are crucial for the successful assembly of peptides. Its characteristics, including solubility and reactivity, make it a valuable intermediate in the development of peptide-based therapeutics and research applications.

Formula: C39H34N2O5

InChI: InChI=1S/C39H34N2O5/c1-41(38(45)46-26-34-32-23-13-11-21-30(32)31-22-12-14-24-33(31)34)35(37(43)44)25-36(42)40-39(27-15-5-2-6-16-27,28-17-7-3-8-18-28)29-19-9-4-10-20-29/h2-24,34-35H,25-26H2,1H3,(H,40,42)(H,43,44)/t35-/m0/s1

InChI key: YZBDIRBPZCFMAZ-DHUJRADRSA-N

SMILES: CN([C@@H](CC(=O)NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O)C(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46

Fmoc-N-Me-Asn(Trt)-OH

CAS: 941296-80-6

Fmoc-N-Me-Asn(Trt)-OH

Formula: C₃₉H₃₄N₂O₅

Purity: >97%

Color and Shape: Solid

Molecular weight: 610.7

Ref: 54-OR1013378

(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-4-oxo-4-(tritylamino)butanoic acid

CAS: 941296-80-6

Formula: C₃₉H₃₄N₂O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 610.6977

Ref: IN-DA00GV95

Fmoc-N-Me-Asn(Trt)-OH

CAS: 941296-80-6

(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-4-oxo-4-(tritylamino)butanoic acid

Formula: C₃₉H₃₄N₂O₅

Purity: 95%

Molecular weight: 610.7

Ref: IN-DG223939

Fmoc-N-Me-Asn(Trt)-OH

CAS: 941296-80-6

Purity: 98%

Molecular weight: 610.247

Ref: 10-F626970

Fmoc-N-Me-Asn(Trt)-OH

CAS: 941296-80-6

Fmoc-N-Me-Asn(Trt)-OH is a peptidomimetic that mimics the sequence of the serine protease. The Fmoc group on the N-terminal amino acid is used to protect against proteolytic degradation and its methyl ester group confers stability in biological fluids. The Fmoc-N-Me-Asn(Trt)-OH has been shown to have minimal effects on endogenous protein synthesis, while also being quantified with high sensitivity and specificity. This compound has been shown to inhibit protein-protein interactions by acting as a competitive inhibitor of serine proteases.

Formula: C₃₉H₃₄N₂O₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 610.7 g/mol

Ref: 3D-FF72659