CAS 94135-22-5
:4-(Acetylamino)-5-bromo-N-[2-(diethylamino)ethyl]-2-methoxybenzamide
Description:
4-(Acetylamino)-5-bromo-N-[2-(diethylamino)ethyl]-2-methoxybenzamide, with the CAS number 94135-22-5, is a synthetic organic compound characterized by its complex structure, which includes a benzamide core substituted with an acetylamino group, a bromo atom, and a diethylaminoethyl side chain. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity due to its amine and aromatic functionalities. The presence of the bromine atom may impart unique reactivity and influence the compound's pharmacological properties. Additionally, the methoxy group can enhance lipophilicity, affecting its interaction with biological membranes. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential to interact with various biological targets. As with many synthetic compounds, safety and handling precautions should be observed, given the potential for toxicity associated with certain functional groups.
Formula:C16H24BrN3O3
InChI:InChI=1/C16H24BrN3O3/c1-5-20(6-2)8-7-18-16(22)12-9-13(17)14(19-11(3)21)10-15(12)23-4/h9-10H,5-8H2,1-4H3,(H,18,22)(H,19,21)
InChI key:InChIKey=UOWCNHGEKKEIDG-UHFFFAOYSA-N
SMILES:C(NCCN(CC)CC)(=O)C1=C(OC)C=C(NC(C)=O)C(Br)=C1
Synonyms:- Benzamide, 4-(acetylamino)-5-bromo-N-[2-(diethylamino)ethyl]-2-methoxy-
- 4-(Acetylamino)-5-bromo-N-[2-(diethylamino)ethyl]-2-methoxybenzamide
- 4-(Acetylamino)-5-bromo-N-(2-(diethylamino)ethyl)-2-methoxybenzamide
- 4-acetamido-5-bromo-N-[2-(diethylamino)ethyl]-2-methoxybenzamide
- Bromopride Impurity A
- N-Acetal Bromopride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Bromopride Impurity 2
CAS:Formula:C16H24BrN3O3Color and Shape:White To Off-White SolidMolecular weight:386.29N-Acetal Bromopride
CAS:Controlled ProductApplications N-Acetal Bromopride is an impurity of bromopride, which is an antiemetic.
References Fontaine, J., et al.: Arch. Int. Pharmacodyn. Ther., 213, 322 (1975), Lucker, P.W., et al.: Arzneim.-Forsch., 33, 453 (1983)Formula:C16H24BrN3O3Color and Shape:NeatMolecular weight:386.28N-Acetal bromopride
CAS:N-Acetal bromopride is a chemical compound that serves as a derivative of bromopride, which is a selective dopamine D2 receptor antagonist. This derivative is synthesized from bromopride, typically through organic chemical processes, and modified to possess an acetal functional group. The presence of this functional group potentially alters its pharmacokinetic or pharmacodynamic properties, although these specific changes may still be under research.Formula:C16H24BrN3O3Purity:Min. 95%Molecular weight:386.28 g/mol



