CymitQuimica logo

CAS 941685-27-4

:

4-(1H-Pyrazol-4-yl)-7-((2-(trimethylsilyl)ethoxy)methyl-7H-pyrrolo[2,3-d]pyrimidine

Description:
4-(1H-Pyrazol-4-yl)-7-((2-(trimethylsilyl)ethoxy)methyl-7H-pyrrolo[2,3-d]pyrimidine is a complex organic compound characterized by its unique structural features, which include a pyrazole ring and a pyrrolo[2,3-d]pyrimidine framework. This compound typically exhibits properties such as moderate solubility in organic solvents, which may vary depending on the presence of functional groups like the trimethylsilyl ether. The presence of the pyrazole moiety suggests potential biological activity, as pyrazoles are often found in pharmaceuticals and agrochemicals. The trimethylsilyl group can enhance the compound's stability and influence its reactivity, making it useful in synthetic applications. Additionally, the ethoxy group may contribute to the compound's solubility and interaction with biological targets. Overall, this compound's intricate structure and functional groups suggest it may have applications in medicinal chemistry, particularly in the development of new therapeutic agents. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C15H21N5OSi
InChI:InChI=1S/C15H21N5OSi/c1-22(2,3)7-6-21-11-20-5-4-13-14(12-8-18-19-9-12)16-10-17-15(13)20/h4-5,8-10H,6-7,11H2,1-3H3,(H,18,19)
InChI key:AVMLPTWVYQXRSV-UHFFFAOYSA-N
SMILES:C[Si](C)(C)CCOCN1C=CC2=C(N=CN=C21)C3=CNN=C3
Found 13 products.