CAS 942-05-2
:2-naphthalen-1-ylethanamine hydrochloride
Description:
2-Naphthalen-1-ylethanamine hydrochloride, with the CAS number 942-05-2, is a chemical compound characterized by its structure, which includes a naphthalene ring substituted with an ethylamine group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it useful in different chemical applications. It is often studied for its potential biological activities, including its role as a precursor in the synthesis of pharmaceuticals or as a ligand in coordination chemistry. The hydrochloride salt form enhances its stability and solubility, which is advantageous for various laboratory and industrial processes. As with many amines, it may exhibit basic properties and can participate in various chemical reactions, including alkylation and acylation. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled, and appropriate personal protective equipment should be used.
Formula:C12H14ClN
InChI:InChI=1/C12H13N.ClH/c13-9-8-11-6-3-5-10-4-1-2-7-12(10)11;/h1-7H,8-9,13H2;1H
SMILES:c1ccc2c(c1)cccc2CCN.Cl
Synonyms:- 1-Naphthaleneethanamine HCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(naphthalen-1-yl)ethan-1-amine hydrochloride
CAS:Formula:C12H14ClNColor and Shape:SolidMolecular weight:207.6993
