CAS 942-58-5
:1-(1-Methylethyl)-2-(2-propen-1-yloxy)benzene
Description:
1-(1-Methylethyl)-2-(2-propen-1-yloxy)benzene, commonly known as isobutyl allyl ether, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both an isobutyl group and an allyloxy group. This compound typically exhibits a clear to pale yellow liquid form and has a distinctive sweet, floral odor. It is relatively hydrophobic, making it soluble in organic solvents but not in water. The presence of the allyloxy group allows for potential reactivity in polymerization and other chemical reactions, making it useful in various industrial applications, including as a chemical intermediate and in the synthesis of fragrances and flavoring agents. Additionally, it may have applications in the production of polymers and resins due to its ability to participate in cross-linking reactions. Safety data should be consulted for handling, as it may pose health risks if inhaled or ingested, and appropriate precautions should be taken during use.
Formula:C12H16O
InChI:InChI=1S/C12H16O/c1-4-9-13-12-8-6-5-7-11(12)10(2)3/h4-8,10H,1,9H2,2-3H3
InChI key:InChIKey=ZRTGNSUOVSGTFW-UHFFFAOYSA-N
SMILES:O(CC=C)C1=C(C(C)C)C=CC=C1
Synonyms:- Ether, allyl o-cumenyl
- 1-(1-Methylethyl)-2-(2-propen-1-yloxy)benzene
- Benzene, 1-(1-methylethyl)-2-(2-propenyloxy)-
- 1-Propan-2-yl-2-prop-2-enoxybenzene
- Benzene, 1-(1-methylethyl)-2-(2-propen-1-yloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Allyl O-Cumenyl Ether
CAS:Controlled ProductApplications Allyl O-Cumenyl Ether is an intermediate in the synthesis of Propofol (P829750) related compounds and derivatives.
References Kohnen, S.L., et al.: Nitric Oxide, 8, 170 (2003)Formula:C12H16OColor and Shape:NeatMolecular weight:176.26

