CAS 94200-15-4
:Ethanone, 1-(3,5-dihydroxyphenyl)-2-[(1-methylethyl)amino]-, sulfate (2:1)
Description:
Ethanone, 1-(3,5-dihydroxyphenyl)-2-[(1-methylethyl)amino]-, sulfate (2:1), commonly referred to as a derivative of a phenolic compound, exhibits several notable characteristics. This compound features a ketone functional group (ethanone) and is characterized by the presence of a 3,5-dihydroxyphenyl moiety, which contributes to its potential biological activity, particularly in the context of antioxidant properties. The presence of an isopropylamino group suggests that it may interact with biological systems, potentially influencing neurotransmitter activity or other physiological processes. The sulfate moiety indicates that the compound is likely to be soluble in water, enhancing its bioavailability. Additionally, the structural complexity of this compound may lead to interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its CAS number, 94200-15-4, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and biochemistry. Overall, this compound's unique structure and functional groups suggest potential utility in therapeutic applications.
Formula:C11H17NO7S
InChI:InChI=1/2C11H15NO3.H2O4S/c2*1-7(2)12-6-11(15)8-3-9(13)5-10(14)4-8;1-5(2,3)4/h2*3-5,7,12-14H,6H2,1-2H3;(H2,1,2,3,4)
InChI key:InChIKey=VCACRTUKGUVTCR-UHFFFAOYSA-N
SMILES:C(CNC(C)C)(=O)C1=CC(O)=CC(O)=C1.S(=O)(=O)(O)O
Synonyms:- Ethanone, 1-(3,5-dihydroxyphenyl)-2-[(1-methylethyl)amino]-, sulfate (2:1)
- Ethanone, 1-(3,5-dihydroxyphenyl)-2-[(1-methylethyl)amino]-, sulfate (2:1) (salt)
- [2-(3,5-Dihydroxyphenyl)-2-Oxo-Ethyl]-Isopropyl-Ammonium Sulfate
- Bis((2-(3,5-dihydroxyphenyl)-2-oxoethyl)isopropylammonium) sulphate
- Alupentketone Sulfate
- [2-(3,5-dihydroxyphenyl)-2-oxoethyl]-propan-2-ylazanium
- 3',5'-DIHYDROXY-2-(ISOPROPYLAMINO)ACETOPHENONE HEMISULFATE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
bis[[2-(3,5-Dihydroxyphenyl)-2-oxoethyl]isopropylammonium] Sulphate
CAS:Controlled ProductApplications Alupentketone Sulfate has therapeutic properties.
Formula:C11H15NO3·H2O4SColor and Shape:NeatMolecular weight:516.562
