CymitQuimica logo

CAS 942070-47-5

:

tert-butyl 3-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine-1-carboxylate

Description:
Tert-butyl 3-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine-1-carboxylate, identified by its CAS number 942070-47-5, is a chemical compound characterized by its complex structure that includes a pyrrolo[2,3-b]pyridine core and a tert-butyl ester functional group. This compound features a dioxaborolane moiety, which is known for its utility in organic synthesis, particularly in the formation of boron-containing compounds. The presence of the tert-butyl group enhances the compound's lipophilicity, potentially influencing its solubility and reactivity in various chemical environments. The pyrrolo[2,3-b]pyridine structure contributes to its biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit unique electronic properties due to the conjugation within its aromatic systems. Overall, this compound's characteristics suggest potential applications in pharmaceuticals and materials science, although specific reactivity and stability would depend on the conditions under which it is used.
Formula:C18H25BN2O4
InChI:InChI=1S/C18H25BN2O4/c1-16(2,3)23-15(22)21-11-13(12-9-8-10-20-14(12)21)19-24-17(4,5)18(6,7)25-19/h8-11H,1-7H3
InChI key:FWSVXYOMGFESAP-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CN(C3=C2C=CC=N3)C(=O)OC(C)(C)C
Found 4 products.