
CAS 942070-67-9
:1-Methyl-2-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazole
Description:
1-Methyl-2-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazole is a chemical compound characterized by its imidazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms. The presence of a methyl group and a phenyl group on the imidazole ring contributes to its unique properties, including potential applications in medicinal chemistry and organic synthesis. The compound also features a boron-containing moiety, specifically a tetramethyl-1,3,2-dioxaborolane, which can enhance its reactivity and solubility in various organic solvents. This structure may facilitate interactions in catalytic processes or serve as a building block in the synthesis of more complex molecules. The compound's stability, solubility, and reactivity can be influenced by the substituents on the imidazole and boron groups, making it a subject of interest in research related to organoboron chemistry and drug development. Overall, its unique structural features position it as a versatile compound in various chemical applications.
Formula:C16H21BN2O2
InChI:InChI=1S/C16H21BN2O2/c1-15(2)16(3,4)21-17(20-15)13-11-18-14(19(13)5)12-9-7-6-8-10-12/h6-11H,1-5H3
InChI key:InChIKey=PCUXLSMJBFGORP-UHFFFAOYSA-N
SMILES:CN1C(B2OC(C)(C)C(C)(C)O2)=CN=C1C3=CC=CC=C3
Synonyms:- 1-Methyl-2-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazole
- 1H-Imidazole, 1-methyl-2-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Methyl-2-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazole
CAS:Formula:C16H21BN2O2Molecular weight:284.1611
