CAS 94242-85-0
:Methyl boronic acid pinacol ester
Description:
Methyl boronic acid pinacol ester, with the CAS number 94242-85-0, is an organoboron compound characterized by the presence of a boron atom bonded to a methyl group and a pinacol ester moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its utility in organic synthesis, particularly in cross-coupling reactions such as Suzuki-Miyaura coupling, where it acts as a boron source for the formation of carbon-carbon bonds. The presence of the pinacol ester enhances its stability and solubility in organic solvents, making it a valuable reagent in various chemical transformations. Methyl boronic acid pinacol ester is generally sensitive to moisture and air, necessitating careful handling and storage under inert conditions. Its reactivity is attributed to the boron atom, which can participate in nucleophilic attacks and coordinate with other electrophiles, making it a versatile intermediate in the synthesis of pharmaceuticals and agrochemicals.
Formula:C7H15BO2
InChI:InChI=1S/C7H15BO2/c1-6(2)7(3,4)10-8(5)9-6/h1-5H3
InChI key:FOQJHZPURACERJ-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C
Synonyms:- Methylboronic acid pinacol ester
- Pinacol cyclic methaneboronate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,4,4,5,5-Pentamethyl-1,3,2-dioxaborolane
CAS:Formula:C7H15BO2Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:142.012,4,4,5,5-Pentamethyl-1,3,2-dioxaborolane
CAS:Formula:C7H15BO2Purity:97%Color and Shape:LiquidMolecular weight:142.0038Methylboronic acid pinacol ester
CAS:Methylboronic acid pinacol esterFormula:C7H15BO2Purity:>98%Color and Shape:LiquidMolecular weight:142.00382,4,4,5,5-Pentamethyl-1,3,2-dioxaborolane
CAS:2,4,4,5,5-Pentamethyl-1,3,2-dioxaborolaneFormula:C7H15BO2Purity:98%Molecular weight:142.02,4,4,5,5-Pentamethyl-1,3,2-dioxaborolane
CAS:Formula:C7H15BO2Purity:97%Color and Shape:LiquidMolecular weight:142.01Methylboronic acid pinacol ester
CAS:Methylboronic acid pinacol ester is an orally administered compound that inhibits the activity of peptidases and imidazole derivatives. It is used as a medicinal preparation for the treatment of cancer and other diseases. Methylboronic acid pinacol ester has been shown to inhibit the growth of bacteria, including Gram-positive bacteria such as methicillin-resistant Staphylococcus aureus (MRSA) and Clostridium perfringens. This compound also has an inhibitory effect on hydroxyl group metabolism, which may be related to its anti-inflammatory properties.Formula:C7H15BO2Purity:Min. 95%Color and Shape:Colourless liquid.Molecular weight:142 g/molRef: 3D-FM38544
Discontinued product





