CAS 942474-21-7
:4-[2-(Methylsulfonyl)phenyl]-1-piperazineethanol
Description:
4-[2-(Methylsulfonyl)phenyl]-1-piperazineethanol, identified by its CAS number 942474-21-7, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a phenyl group substituted with a methylsulfonyl group, contributing to its unique properties. The presence of the hydroxyl group (ethanol moiety) enhances its solubility in polar solvents and may influence its biological activity. Typically, compounds like this may exhibit pharmacological properties, potentially acting as intermediates in drug synthesis or as active pharmaceutical ingredients. The methylsulfonyl group can enhance the compound's metabolic stability and bioavailability. Additionally, the structural configuration suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Overall, the characteristics of this compound, including its molecular structure and functional groups, suggest a versatile role in various chemical and biological applications.
Formula:C13H20N2O3S
InChI:InChI=1S/C13H20N2O3S/c1-19(17,18)13-5-3-2-4-12(13)15-8-6-14(7-9-15)10-11-16/h2-5,16H,6-11H2,1H3
InChI key:InChIKey=BOKCECYUMLGFQV-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(C=CC=C1)N2CCN(CCO)CC2
Synonyms:- 4-[2-(Methylsulfonyl)phenyl]-1-piperazineethanol
- 1-Piperazineethanol, 4-[2-(methylsulfonyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(2-Hydroxyethyl)-4-[2-(methylsulphonyl)phenyl]piperazine
CAS:1-(2-Hydroxyethyl)-4-[2-(methylsulphonyl)phenyl]piperazineFormula:C13H20N2O3SMolecular weight:284.3745

