CAS 942515-63-1
:Pyraziflumid
Description:
Pyraziflumid is a chemical compound classified as a fungicide, primarily used in agricultural applications to control various fungal diseases in crops. It belongs to the class of pyrazole derivatives and is characterized by its unique molecular structure, which contributes to its efficacy as a plant protection product. Pyraziflumid operates by inhibiting specific enzymes involved in the fungal respiration process, thereby disrupting the growth and reproduction of target fungi. This compound is known for its systemic properties, allowing it to be absorbed and translocated within plants, providing effective protection against pathogens. Additionally, Pyraziflumid exhibits low toxicity to non-target organisms, making it a more environmentally friendly option compared to some traditional fungicides. Its application is typically in the form of foliar sprays or soil treatments, and it is effective against a range of fungal pathogens, including those affecting fruits, vegetables, and ornamental plants. As with any chemical substance, proper handling and adherence to safety guidelines are essential to minimize risks associated with its use.
Formula:C18H10F5N3O
InChI:InChI=1S/C18H10F5N3O/c19-12-6-5-10(9-13(12)20)11-3-1-2-4-14(11)26-17(27)15-16(18(21,22)23)25-8-7-24-15/h1-9H,(H,26,27)
InChI key:InChIKey=KKEJMLAPZVXPOF-UHFFFAOYSA-N
SMILES:N(C(=O)C=1C(C(F)(F)F)=NC=CN1)C2=C(C=CC=C2)C3=CC(F)=C(F)C=C3
Synonyms:- 2-Pyrazinecarboxamide, N-(3′,4′-difluoro[1,1′-biphenyl]-2-yl)-3-(trifluoromethyl)-
- NNF 0721
- Pyraziflumid
- N-(3′,4′-Difluoro[1,1′-biphenyl]-2-yl)-3-(trifluoromethyl)-2-pyrazinecarboxamide
- N-(3',4'-difluorobiphenyl-2-yl)-3-(trifluoromethyl)pyrazine-2-carboxamide
- N-[2-(3,4-Difluorophenyl)phenyl]-3-trifluoromethylpyrazine-2-carboxamide
- 2-Pyrazinecarboxamide, N-(3',4'-difluoro[1,1'-biphenyl]-2-yl)-3-(trifluoromethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Pyraziflumid 100 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C18H10F5N3OColor and Shape:Single SolutionMolecular weight:379.28Pyraziflumid
CAS:Pyraziflumid is a fungicide, which is chemically synthesized with a specific mode of action as a succinate dehydrogenase inhibitor (SDHI). This compound is designed to target mitochondrial complex II, disrupting critical energy production within fungal cells. The inhibition of succinate dehydrogenase prevents the fungi from efficiently undergoing respiration, ultimately leading to cell death.Formula:C18H10F5N3OPurity:Min. 95%Molecular weight:379.3 g/molPyraziflumid
CAS:Pyraziflumid: a novel SDHI fungicide with an EC50 of 0.0561 μg/ml; no cross-resistance with carbendazim, dimethachlon, or fludioxonil.Formula:C18H10F5N3OColor and Shape:SolidMolecular weight:379.28



