CAS 94278-27-0
:Ethyl 3-[(2-furanylmethyl)thio]propanoate
Description:
Ethyl 3-[(2-furanylmethyl)thio]propanoate, identified by its CAS number 94278-27-0, is an organic compound characterized by its ester functional group, which is derived from propanoic acid and ethyl alcohol. The presence of a furan ring in its structure contributes to its unique chemical properties, including potential reactivity and stability under various conditions. This compound typically exhibits a moderate polarity due to the ester and thioether functionalities, which can influence its solubility in organic solvents. Ethyl 3-[(2-furanylmethyl)thio]propanoate may also display interesting biological activities, making it a subject of interest in medicinal chemistry and synthetic applications. Its synthesis often involves the reaction of furan derivatives with thiol and ester components, highlighting its potential utility in organic synthesis. Additionally, the compound's structural features may allow for various modifications, leading to derivatives with tailored properties for specific applications in pharmaceuticals or agrochemicals. Overall, this compound exemplifies the diverse chemistry associated with esters and heterocyclic compounds.
Formula:C10H14O3S
InChI:InChI=1S/C10H14O3S/c1-2-12-10(11)5-7-14-8-9-4-3-6-13-9/h3-4,6H,2,5,7-8H2,1H3
InChI key:InChIKey=ZKCVVCLCYIXCOD-UHFFFAOYSA-N
SMILES:C(SCCC(OCC)=O)C1=CC=CO1
Synonyms:- 3-(Furfurylthio)propionic acid ethyl ester
- Ethyl 3-(furfurylmercapto)propionate
- Ethyl 3-[(2-furanylmethyl)thio]propanoate
- Ethyl 3-[(Furan-2-Ylmethyl)Sulfanyl]Propanoate
- Propanoic acid, 3-[(2-furanylmethyl)thio]-, ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ethyl 3-(Furfurylthio)Propionate
CAS:Ethyl 3-(Furfurylthio)PropionateFormula:C10H14O3SPurity:98%Molecular weight:214.29Ethyl 3-[(2-furanylmethyl)thio]propanoate
CAS:Formula:C10H14O3SPurity:98%Color and Shape:LiquidMolecular weight:214.2814Ethyl 3-(furfurylthio)propionate
CAS:Ethyl 3-(furfurylthio)propionate is an organic compound that is used in the manufacturing of industrial products, such as plastics and polyurethane. It is a colorless liquid with a pleasant fruity odor. This chemical can be found in many food products, including meats and cheeses. Ethyl 3-(furfurylthio)propionate may be toxic to the human body because it has shown to react with DNA, causing mutations and cancer.Formula:C10H14O3SPurity:Min. 95%Molecular weight:214.28 g/mol



