CAS 943-14-6
:2-Bromo-5-nitrobenzoic acid
Description:
2-Bromo-5-nitrobenzoic acid is an aromatic carboxylic acid characterized by the presence of both a bromine atom and a nitro group on the benzene ring. The molecular formula for this compound is C7H4BrN1O4, indicating it contains seven carbon atoms, four hydrogen atoms, one bromine atom, one nitrogen atom, and four oxygen atoms. This compound typically appears as a yellow crystalline solid and is known for its moderate solubility in organic solvents, while being less soluble in water. The presence of the bromine and nitro substituents contributes to its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in acid-base reactions. Safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled, and appropriate protective equipment should be used.
Formula:C7H4BrNO4
InChI:InChI=1/C7H4BrNO4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,(H,10,11)/p-1
InChI key:InChIKey=UVFWYVCDRKRAJH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(N(=O)=O)=CC=C1Br
Synonyms:- 2-Bromo-5-Nitrobenzoate
- Benzoic Acid, 2-Bromo-5-Nitro-
- NSC 52211
- 2-Bromo-5-nitrobenzoic acid
- TIMTEC-BB SBB003179
- 2-Bromo-5-nitrobenzic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-Bromo-5-nitrobenzoic Acid
CAS:Formula:C7H4BrNO4Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:246.022-Bromo-5-nitrobenzoic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H4BrNO4Purity:98%Color and Shape:Cream to brown, Crystals or powder or crystalline powderMolecular weight:246.022-Bromo-5-nitrobenzoic acid
CAS:2-Bromo-5-nitrobenzoic acidFormula:C7H4BrNO4Purity:98%Molecular weight:246.022-Bromo-5-nitrobenzoic acid
CAS:2-Bromo-5-nitrobenzoic acidFormula:C7H4BrNO4Purity:97%Color and Shape:Solid-CrystalsMolecular weight:246.014952-Bromo-5-nitrobenzoic acid
CAS:Formula:C7H4BrNO4Purity:97%Color and Shape:SolidMolecular weight:246.01502-Bromo-5-nitrobenzoic acid
CAS:BR1601 - 2-Bromo-5-nitrobenzoic acid
Formula:C7H4BrNO4Purity:98%Color and Shape:Powder or Crystalline PowderMolecular weight:246.0162-Bromo-5-nitrobenzoic acid
CAS:2-Bromo-5-nitrobenzoic acid is an amine that has been shown to have a potent inhibitory effect on the enzyme fibrinogen, which is needed for blood clotting. It also inhibits other enzymes in the fibrinogen pathway, including those involved in protein synthesis and cellular metabolism. 2-Bromo-5-nitrobenzoic acid has been shown to inhibit cancer cells by blocking their ability to use amino acids as building blocks for new proteins. This drug may be used as a treatment for cancer and other diseases where protein synthesis is critical.
Formula:C7H4BrNO4Purity:Min. 95%Color and Shape:PowderMolecular weight:246.02 g/mol







