CAS 94345-95-6
:3,5-Diiodo-O-(4-methoxyphenyl)-L-tyrosine
Description:
3,5-Diiodo-O-(4-methoxyphenyl)-L-tyrosine is a synthetic derivative of the amino acid tyrosine, characterized by the presence of two iodine atoms at the 3 and 5 positions of the aromatic ring, as well as a methoxy group attached to the para position of a phenyl ring. This compound is notable for its potential biological activity, particularly in the context of thyroid hormone analogs, due to the iodine substitutions which can influence its interaction with biological systems. The methoxy group enhances lipophilicity, potentially affecting its absorption and distribution in biological environments. The presence of the L-tyrosine backbone suggests that it retains some of the properties of natural amino acids, which may be relevant in biochemical pathways. Its molecular structure allows for various interactions, making it of interest in medicinal chemistry and pharmacology. As with many iodine-containing compounds, it may exhibit unique properties such as increased stability or altered reactivity compared to its non-iodinated counterparts.
Formula:C16H15I2NO4
InChI:InChI=1S/C16H15I2NO4/c1-22-10-2-4-11(5-3-10)23-15-12(17)6-9(7-13(15)18)8-14(19)16(20)21/h2-7,14H,8,19H2,1H3,(H,20,21)/t14-/m0/s1
InChI key:InChIKey=UBTILXPOSFIMMG-AWEZNQCLSA-N
SMILES:O(C1=C(I)C=C(C[C@@H](C(O)=O)N)C=C1I)C2=CC=C(OC)C=C2
Synonyms:- (S)-2-Amino-3-[3,5-diiodo-4-(4-methoxyphenoxy)phenyl]propanoic acid
- 3,5-Diiodo-O-(4-methoxyphenyl)-<span class="text-smallcaps">L</span>-tyrosine
- <span class="text-smallcaps">L</span>-Tyrosine, 3,5-diiodo-O-(4-methoxyphenyl)-
- Alanine, 3-[3,5-diiodo-4-(p-methoxyphenoxy)phenyl]-
- Alanine,3-[3,5-diiodo-4-(p-methoxyphenoxy)phenyl]- (7CI)
- 3,5-Diiodo-O-(4-methoxyphenyl)-L-tyrosine
- L-Tyrosine, 3,5-diiodo-O-(4-methoxyphenyl)-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Levothyroxine Impurity 78
CAS:Formula:C16H15I2NO4Color and Shape:White To Off-White SolidMolecular weight:539.113', 5'-dideiodo-4'-O-methyl Thyroxine
CAS:Controlled ProductFormula:C16H15I2NO4Color and Shape:NeatMolecular weight:539.104(S)-2-Amino-3-(3,5-diiodo-4-(4-methoxyphenoxy)phenyl propanoic acid
CAS:(S)-2-Amino-3-(3,5-diiodo-4-(4-methoxyphenoxy)phenyl propanoic acid is a synthetic compound that is used as an impurity standard. It has been shown to be metabolized by cytochrome P450 enzyme system and its metabolites are excreted in the urine. This chemical can also act as an analytical reference for HPLC analysis of other compounds.Formula:C16H15I2NO4Purity:Min. 95%Molecular weight:539.1 g/mol



