CymitQuimica logo

CAS 94367-35-8

:

L-methionine 4-methyl-7-coumarinylamide trifluoroacetate

Description:
L-methionine 4-methyl-7-coumarinylamide trifluoroacetate is a chemical compound characterized by its unique structure, which combines the amino acid L-methionine with a coumarin derivative. This compound features a trifluoroacetate group, which enhances its solubility and stability in various solvents. The presence of the coumarin moiety imparts fluorescent properties, making it useful in biological and chemical applications, particularly in fluorescence microscopy and as a potential probe for studying biological processes. The trifluoroacetate salt form can influence the compound's reactivity and interaction with biological systems. As an amino acid derivative, it may participate in peptide synthesis and exhibit biological activity, including potential antioxidant properties. Overall, this compound's characteristics make it a valuable tool in both research and potential therapeutic applications, although specific biological effects and mechanisms would require further investigation.
Formula:C17H19F3N2O5S
InChI:InChI=1/C15H18N2O3S.C2HF3O2/c1-9-7-14(18)20-13-8-10(3-4-11(9)13)17-15(19)12(16)5-6-21-2;3-2(4,5)1(6)7/h3-4,7-8,12H,5-6,16H2,1-2H3,(H,17,19);(H,6,7)/t12-;/m0./s1
SMILES:Cc1cc(=O)oc2cc(ccc12)N=C([C@H](CCSC)N)O.C(=O)(C(F)(F)F)O
Synonyms:
  • L-Methionine 4-methyl-7-coumarinylamide trifluoroacetate salt
  • L-Methionine 7-amido-4-methylcoumarin trifluoroacetate salt
  • N-(4-methyl-2-oxo-2H-chromen-7-yl)-L-methioninamide trifluoroacetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.