
CAS 943757-71-9
:(R)-2-(diphenyl(trimethylsilyloxy)methyl)pyrrolidine
Description:
(R)-2-(Diphenyl(trimethylsilyloxy)methyl)pyrrolidine, with CAS number 943757-71-9, is a chiral organic compound characterized by its pyrrolidine backbone, which is a five-membered nitrogen-containing heterocycle. The presence of the diphenyl(trimethylsilyloxy)methyl group introduces significant steric and electronic effects, influencing its reactivity and interactions. This compound is typically used in synthetic organic chemistry, particularly in asymmetric synthesis, due to its chiral nature, which can facilitate the formation of enantiomerically enriched products. The trimethylsilyloxy group enhances the compound's stability and solubility in organic solvents, making it suitable for various chemical reactions. Additionally, the diphenyl moiety contributes to the compound's hydrophobic characteristics, which can affect its behavior in biological systems and its potential applications in medicinal chemistry. Overall, this compound exemplifies the complexity and utility of chiral molecules in advanced organic synthesis and pharmaceutical development.
Formula:C19H23NOSi
InChI:InChI=1/C19H23NOSi/c1-22(2)20-15-9-14-18(20)19(21-22,16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-8,10-13,18H,9,14-15H2,1-2H3/t18-/m1/s1
SMILES:C[Si]1(C)N2CCC[C@@H]2C(c2ccccc2)(c2ccccc2)O1
Synonyms:- (R)-Diphenylprolinol Trimethyl Silyl Ether
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(R)-(+)-α,α-Diphenyl-2-pyrrolidinemethanol Trimethylsilyl Ether
CAS:Formula:C20H27NOSiPurity:>98.0%(GC)(T)Color and Shape:Light orange to Yellow to Green clear liquidMolecular weight:325.53(R)-2-(Diphenyl((trimethylsilyl)oxy)methyl)pyrrolidine
CAS:(R)-2-(Diphenyl((trimethylsilyl)oxy)methyl)pyrrolidineFormula:C20H27NOSiPurity:95%Color and Shape:SolidMolecular weight:325.52(R)-2-(Diphenyl((trimethylsilyl)oxy)methyl)pyrrolidine
CAS:Formula:C20H27NOSiPurity:97%Color and Shape:LiquidMolecular weight:325.5200(R)-Jorgensen-Hayashi Catalyst
CAS:Controlled ProductApplications (R)-Jorgensen-Hayashi Catalyst is a useful catalyst in enantioselective organic reactions.
References Bencivenni, G., et al.: Angew. Chem. Int. Ed., 48, 7200 (2009); Zhu, S., et al.: Angew. Chem. Int. Ed., 47, 545 (2008);Formula:C20H27NOSiPurity:>90%Color and Shape:NeatMolecular weight:325.52(R)-Diphenylprolinol trimethyl silyl ether, 95% (99% ee)
CAS:(R)-Diphenylprolinol trimethyl silyl ether, 95% (99% ee)
Formula:C20H16O2Purity:95% (99% ee)Color and Shape:white to light brown viscous liq.Molecular weight:325.50





