CymitQuimica logo

CAS 943830-81-7

:

3-Bromo-6-chloro-2-fluoroaniline

Description:
3-Bromo-6-chloro-2-fluoroaniline is an organic compound characterized by the presence of multiple halogen substituents on an aniline structure. It features a bromine atom at the 3-position, a chlorine atom at the 6-position, and a fluorine atom at the 2-position of the aromatic ring, which significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent characteristics. The presence of halogens can enhance its reactivity in nucleophilic substitution reactions and may also affect its electronic properties, making it a potential candidate for various applications in pharmaceuticals and agrochemicals. Additionally, the amino group (-NH2) in aniline contributes to its basicity and potential for forming hydrogen bonds, which can influence its interactions in biological systems. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C6H4BrClFN
InChI:InChI=1S/C6H4BrClFN/c7-3-1-2-4(8)6(10)5(3)9/h1-2H,10H2
InChI key:YBQMYAOZKDEJHG-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1Cl)N)F)Br
Found 5 products.