CAS 944-43-4
:4-Amino-2,3,5,6-tetrafluorobenzoic acid
Description:
4-Amino-2,3,5,6-tetrafluorobenzoic acid is an aromatic compound characterized by the presence of an amino group and multiple fluorine substituents on a benzoic acid framework. Its molecular structure features a carboxylic acid group (-COOH) attached to a benzene ring that has four fluorine atoms and one amino group (-NH2) at specific positions, contributing to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid group. The fluorine atoms enhance its reactivity and influence its physical properties, such as melting point and boiling point. 4-Amino-2,3,5,6-tetrafluorobenzoic acid is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its fluorinated nature can impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H3F4NO2
InChI:InChI=1S/C7H3F4NO2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H,13,14)
InChI key:InChIKey=WTNSXWSOTDBWOR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(F)C(F)=C(N)C(F)=C1F
Synonyms:- NSC 98742
- 4-Amino-2,3,5,6-tetrafluorobenzoic acid
- Benzoic acid, 4-amino-2,3,5,6-tetrafluoro-
- 4-Aminotetrafluorobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Amino-2,3,5,6-tetrafluorobenzoic Acid
CAS:Formula:C7H3F4NO2Purity:>97.0%(T)Color and Shape:White to Light red to Green powder to crystallineMolecular weight:209.104-Amino-2,3,5,6-tetrafluorobenzoic acid, 97%
CAS:It is used in chemical research and as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU refeFormula:C7H3F4NO2Purity:97%Color and Shape:White to cream, PowderMolecular weight:209.104-Amino-2,3,5,6-tetrafluorobenzoic acid
CAS:4-Amino-2,3,5,6-tetrafluorobenzoic acidFormula:C7H3F4NO2Purity:98%Molecular weight:209.14-Amino-2,3,5,6-tetrafluorobenzoic acid
CAS:Formula:C7H3F4NO2Purity:97%Color and Shape:SolidMolecular weight:209.09784-Amino-2,3,5,6-tetrafluorobenzoic acid
CAS:Formula:C7H3F4NO2Purity:≥ 97.0%Color and Shape:White to yellow powderMolecular weight:209.114-Amino-2,3,5,6-tetrafluorobenzoic acid
CAS:4-Amino-2,3,5,6-tetrafluorobenzoic acidFormula:C7H3F4NO2Purity:98%Color and Shape:White-pale yellow Solid-CrystalsMolecular weight:209.097834-Amino-2,3,5,6-tetrafluorobenzoic acid
CAS:Formula:C7H3F4NO2Purity:≥97%Color and Shape:Crystalline PowderMolecular weight:209.1






