CAS 94421-69-9
:N-(2-Hydroxyethyl)eicosanamide
Description:
N-(2-Hydroxyethyl)eicosanamide, with the CAS number 94421-69-9, is an amide derivative characterized by a long-chain fatty acid structure. It features a hydrophobic eicosane backbone, which consists of 20 carbon atoms, and a hydroxyl group attached to an ethyl chain, contributing to its amphiphilic nature. This compound is typically used in various applications, including as a surfactant, emulsifier, or stabilizer in formulations due to its ability to interact with both hydrophilic and hydrophobic components. Its molecular structure allows for potential interactions with biological membranes, making it of interest in pharmaceutical and cosmetic formulations. The presence of the hydroxyl group enhances solubility in polar solvents while maintaining the hydrophobic characteristics of the long carbon chain. Additionally, N-(2-Hydroxyethyl)eicosanamide may exhibit properties such as biocompatibility and low toxicity, which are advantageous for its use in various industrial and research applications. Overall, its unique structural features contribute to its functional versatility in chemical and biological systems.
Formula:C22H45NO2
InChI:InChI=1S/C22H45NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)23-20-21-24/h24H,2-21H2,1H3,(H,23,25)
InChI key:InChIKey=AUJVQJHODMISJP-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCCCC)CC(NCCO)=O
Synonyms:- Eicosanoic acid monoethanolamide
- Eicosanoicacid monoethanolamide
- N-(2-Hydroxyethyl)eicosanamide
- N-Arachidoylethanolamine
- N-Eicosanoylethanolamine
- Eicosanamide, N-(2-hydroxyethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Arachidoyl Ethanolamide
CAS:Arachidoyl EthanolamideFormula:C22H45NO2Purity:≥95%Molecular weight:355.6N-(2-hydroxyethyl)-eicosanamide
CAS:Formula:C22H45NO2Purity:>98%Color and Shape:SolidMolecular weight:355.6Arachidoyl Ethanolamide
CAS:Arachidoyl ethanolamide, a saturated fatty acyl ethanolamide lacking classical (CB1/CB2) activity, plays a role in a complex system comprising central cannabinoid (CB1), peripheral cannabinoid (CB2), and non-CB receptor-mediated pharmacology. This system has paved the way for extensive research in diverse fields such as memory, weight loss and appetite, neurodegeneration, tumor surveillance, analgesia, and inflammation. Unlike other compounds, Arachidoyl ethanolamide does not bind to the murine CB1 receptor nor does it compete with anandamide for the fatty acid amide hydrolase, the endocannabinoid hydrolytic enzyme. The non-CB receptor-mediated actions of saturated ethanolamides like Arachidoyl ethanolamide are currently under investigation.Formula:C22H45NO2Color and Shape:SolidMolecular weight:355.607



