CymitQuimica logo

CAS 94427-22-2

:

Benzene, [[(7-bromoheptyl)oxy]methyl]-

Description:
Benzene, [[(7-bromoheptyl)oxy]methyl]- (CAS 94427-22-2) is an organic compound characterized by its benzene ring structure substituted with a heptyl group that contains a bromine atom and a methoxy group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The heptyl chain contributes to the hydrophobic nature of the molecule, influencing its solubility and interaction with other substances. This compound may exhibit properties typical of both aromatic compounds and alkyl halides, such as stability under certain conditions and potential for electrophilic aromatic substitution. Its applications could span fields like organic synthesis, materials science, or pharmaceuticals, depending on the specific functional groups and their reactivity. Safety considerations are essential when handling this compound due to the presence of bromine, which can be hazardous. Overall, the unique structure of this compound allows for diverse chemical behavior and potential applications in various scientific domains.
Formula:C14H21BrO
InChI:InChI=1S/C14H21BrO/c15-11-7-2-1-3-8-12-16-13-14-9-5-4-6-10-14/h4-6,9-10H,1-3,7-8,11-13H2
InChI key:BZMIZZYCYWAKIC-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)COCCCCCCCBr
Found 6 products.