CAS 944328-72-7

4,4-Difluorobutanoic acid

Description:

4,4-Difluorobutanoic acid is a fluorinated carboxylic acid characterized by the presence of two fluorine atoms attached to the fourth carbon of a four-carbon butanoic acid chain. Its molecular formula is C4H6F2O2, and it features a carboxylic acid functional group (-COOH) that imparts acidic properties. The presence of fluorine atoms enhances its chemical reactivity and can influence its physical properties, such as solubility and boiling point. Typically, fluorinated compounds exhibit unique characteristics, including increased lipophilicity and altered biological activity. 4,4-Difluorobutanoic acid may be utilized in various applications, including pharmaceuticals, agrochemicals, and materials science, due to its potential as a building block in organic synthesis. Its CAS number, 944328-72-7, allows for easy identification and reference in chemical databases. As with many fluorinated compounds, safety and handling precautions are essential, given the potential for environmental persistence and biological effects.

Formula: C₄H₆F₂O₂

InChI: InChI=1S/C4H6F2O2/c5-3(6)1-2-4(7)8/h3H,1-2H2,(H,7,8)

InChI key: InChIKey=KATHHSJRHUEROK-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C(F)F

Synonyms:

• Butanoic acid, 4,4-difluoro-
• 4,4-Difluorobutanoic acid

4,4-difluorobutanoic acid

CAS: 944328-72-7

4,4-difluorobutanoic acid

Formula: C₄H₆F₂O₂

Purity: 95%

Molecular weight: 124.09

Ref: IN-DG223278

4,4-difluorobutanoic acid

CAS: 944328-72-7

Formula: C₄H₆F₂O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 124.0860

Ref: IN-DA006B2K

4,4-Difluorobutanoic acid

CAS: 944328-72-7

4,4-Difluorobutanoic acid

Formula: C₄H₆F₂O₂

Purity: 95%

Molecular weight: 124.09

Ref: 54-PC102838

4,4-Difluorobutanoic acid

CAS: 944328-72-7

Purity: 95%

Color and Shape: Liquid

Molecular weight: 124.086998

Ref: 10-F760323