CAS 944450-82-2
:3-Thiophenemethanamine, 4-bromo-N-methyl-, hydrochloride (1:1)
Description:
3-Thiophenemethanamine, 4-bromo-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its thiophene ring structure, which contributes to its aromatic properties and potential reactivity. The presence of a bromine atom at the 4-position of the thiophene ring enhances its electrophilic character, making it suitable for various chemical reactions. The N-methyl group indicates that the amine is tertiary, which can influence its solubility and interaction with biological systems. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, facilitating its use in pharmaceutical applications. This compound may exhibit biological activity, potentially acting as a ligand or modulator in various biochemical pathways. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the conditions under which it is studied. Overall, 3-Thiophenemethanamine, 4-bromo-N-methyl-, hydrochloride is of interest in medicinal chemistry and materials science due to its unique structural features and potential applications.
Formula:C6H8BrNS·ClH
InChI:InChI=1S/C6H8BrNS.ClH/c1-8-2-5-3-9-4-6(5)7;/h3-4,8H,2H2,1H3;1H
InChI key:InChIKey=GORGMQYTNXIOBQ-UHFFFAOYSA-N
SMILES:C(NC)C=1C(Br)=CSC1.Cl
Synonyms:- 3-Thiophenemethanamine, 4-bromo-N-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-Bromo-4-[(methylamino)methyl]thiophene hydrochloride
CAS:3-Bromo-4-[(methylamino)methyl]thiophene hydrochlorideFormula:C6H8BrNS·ClHPurity:techColor and Shape:Light yellow Solid-PowderMolecular weight:242.564353-Bromo-4-[(methylamino)methyl]thiophene hydrochloride tech
CAS:Formula:C6H9BrClNSMolecular weight:242.5644


