CAS 94446-97-6
:2-Bromo-3-(bromomethyl)pyridine
Description:
2-Bromo-3-(bromomethyl)pyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with bromine atoms. Specifically, it features a bromine atom at the 2-position and a bromomethyl group at the 3-position of the pyridine ring. This compound is typically a colorless to light yellow liquid or solid, depending on its form and purity. It is known for its reactivity due to the presence of multiple bromine substituents, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound is often used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a building block for more complex molecules. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous.
Formula:C6H5Br2N
InChI:InChI=1/C6H5Br2N/c7-4-5-2-1-3-9-6(5)8/h1-3H,4H2
SMILES:c1cc(CBr)c(Br)nc1
Synonyms:- Pyridine, 2-Bromo-3-(Bromomethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromo-3-(bromomethyl)pyridine, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H5Br2NPurity:96%Color and Shape:White to yellow, SolidMolecular weight:250.922-Bromo-3-(bromomethyl)pyridine
CAS:2-Bromo-3-(bromomethyl)pyridineFormula:C6H5Br2NPurity:≥95%Color and Shape:Solid-PowderMolecular weight:250.91862-Bromo-3-(bromomethyl)pyridine
CAS:Formula:C6H5Br2NPurity:95%Color and Shape:SolidMolecular weight:250.9186




