CymitQuimica logo

CAS 944467-87-2

:

2-Furancarboxylic acid, 3-(aminomethyl)-, hydrochloride (1:1)

Description:
2-Furancarboxylic acid, 3-(aminomethyl)-, hydrochloride (1:1), also known by its CAS number 944467-87-2, is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a carboxylic acid functional group and an aminomethyl substituent, contributing to its potential as a versatile building block in organic synthesis. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which often enhances its solubility in water and stability. Typically, such compounds exhibit properties like moderate to high polarity due to the presence of both the carboxylic acid and amine groups, which can engage in hydrogen bonding. The presence of these functional groups also suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in chemical synthesis. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications.
Formula:C6H7NO3·ClH
InChI:InChI=1S/C6H7NO3.ClH/c7-3-4-1-2-10-5(4)6(8)9;/h1-2H,3,7H2,(H,8,9);1H
InChI key:InChIKey=OQKOZKIBMKSAHU-UHFFFAOYSA-N
SMILES:C(N)C1=C(C(O)=O)OC=C1.Cl
Synonyms:
  • 2-Furancarboxylic acid, 3-(aminomethyl)-, hydrochloride (1:1)
  • 3-Aminomethyl-furan-2-carboxylic acid; hydrochloride
Found 1 products.