CymitQuimica logo

CAS 944582-93-8

:

1-(5-Bromo-4-methyl-2-pyridinyl)piperazine

Description:
1-(5-Bromo-4-methyl-2-pyridinyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 5-bromo and a 4-methyl substituent on the pyridine ring contributes to its unique properties. This compound is typically classified as a heterocyclic organic compound due to the inclusion of nitrogen in its structure. It may exhibit biological activity, making it of interest in medicinal chemistry and pharmaceutical research. The bromine atom can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the methyl group can affect the compound's steric and electronic properties. Its molecular structure allows for potential applications in drug development, particularly in areas targeting neurological or psychiatric disorders, given the known activity of piperazine derivatives. As with many chemical substances, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would require further investigation.
Formula:C10H14BrN3
InChI:InChI=1S/C10H14BrN3/c1-8-6-10(13-7-9(8)11)14-4-2-12-3-5-14/h6-7,12H,2-5H2,1H3
InChI key:InChIKey=KMVMTDWWYHSLGI-UHFFFAOYSA-N
SMILES:CC=1C=C(N=CC1Br)N2CCNCC2
Synonyms:
  • 1-(5-Bromo-4-methyl-2-pyridinyl)piperazine
  • Piperazine, 1-(5-bromo-4-methyl-2-pyridinyl)-
Found 2 products.