CymitQuimica logo

CAS 944804-88-0

:

tert-Butyl (4-bromo-1,3-thiazol-2-yl)carbamate

Description:
Tert-Butyl (4-bromo-1,3-thiazol-2-yl)carbamate is a chemical compound characterized by its unique structure, which includes a tert-butyl group, a brominated thiazole ring, and a carbamate functional group. The presence of the thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The bromine atom introduces a halogen, which can enhance the compound's reactivity and influence its interactions in biological systems. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its stability can be influenced by environmental factors such as temperature and pH. The carbamate group is known for its ability to form hydrogen bonds, which can affect the compound's solubility and reactivity. Overall, tert-Butyl (4-bromo-1,3-thiazol-2-yl)carbamate is of interest in medicinal chemistry and may serve as a lead compound for further development in drug discovery or agricultural applications.
Formula:C8H11BrN2O2S
InChI:InChI=1/C8H11BrN2O2S/c1-8(2,3)13-7(12)11-6-10-5(9)4-14-6/h4H,1-3H3,(H,10,11,12)
InChI key:OVRIFGLINJVMLO-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=Nc1nc(cs1)Br)O
Synonyms:
  • Tert-Butyl 4-Bromothiazol-2-Ylcarbamate
Found 4 products.