
CAS 94483-60-0
:N-(4,5,7-Tricarboxy-1-oxoheptyl)-L-γ-glutamyl-N-[2-[4-[[5-[(formylamino)methyl]-3-furanyl]methoxy]phenyl]ethyl]-L-glutamine
Description:
N-(4,5,7-Tricarboxy-1-oxoheptyl)-L-γ-glutamyl-N-[2-[4-[[5-[(formylamino)methyl]-3-furanyl]methoxy]phenyl]ethyl]-L-glutamine, with CAS number 94483-60-0, is a complex organic compound characterized by its multiple functional groups and structural features. This substance contains several carboxylic acid groups, which contribute to its acidity and potential for forming salts or complexes with metal ions. The presence of amino acid residues, specifically L-glutamine and L-γ-glutamyl, suggests that it may participate in biological processes or interactions, potentially influencing protein synthesis or metabolic pathways. Additionally, the furan and phenyl moieties indicate that the compound may exhibit aromatic properties, which can affect its solubility and reactivity. The overall structure implies that it could be involved in various chemical reactions, including those typical of amino acids and derivatives, such as peptide bond formation. Its intricate design may also suggest potential applications in pharmaceuticals or biochemistry, particularly in drug design or as a biochemical probe.
Formula:C35H44N4O16
InChI:InChI=1S/C35H44N4O16/c40-19-36-16-23-15-21(18-55-23)17-54-22-3-1-20(2-4-22)13-14-37-28(41)10-7-26(34(50)51)39-30(43)11-8-27(35(52)53)38-29(42)9-5-24(32(46)47)25(33(48)49)6-12-31(44)45/h1-4,15,18-19,24-27H,5-14,16-17H2,(H,36,40)(H,37,41)(H,38,42)(H,39,43)(H,44,45)(H,46,47)(H,48,49)(H,50,51)(H,52,53)/t24?,25?,26-,27-/m0/s1
InChI key:InChIKey=RGBIJPWAWLXPOC-NBAFEDJBSA-N
SMILES:C(OC1=CC=C(CCNC(CC[C@H](NC(CC[C@H](NC(CCC(C(CCC(O)=O)C(O)=O)C(O)=O)=O)C(O)=O)=O)C(O)=O)=O)C=C1)C=2C=C(CNC=O)OC2
Synonyms:- N-Formylmethanofuran
- L-Glutamine, N-(4,5,7-tricarboxy-1-oxoheptyl)-L-γ-glutamyl-N-[2-[4-[[5-[(formylamino)methyl]-3-furanyl]methoxy]phenyl]ethyl]-
- N-(4,5,7-Tricarboxy-1-oxoheptyl)-L-γ-glutamyl-N-[2-[4-[[5-[(formylamino)methyl]-3-furanyl]methoxy]phenyl]ethyl]-L-glutamine
- Formylmethanofuran
- L-Glutamine, N-[2-[4-[[5-[(formylamino)methyl]-3-furanyl]methoxy]phenyl]ethyl]-N2-[N-(4,5,7-tricarboxy-1-oxoheptyl)-L-γ-glutamyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Formylmethanofuran
CAS:Formylmethanofuran is regarded as intermediate in the reduction of CO2 to methane.Formula:C35H44N4O16Color and Shape:SolidMolecular weight:776.749
