CymitQuimica logo

CAS 944896-42-8

:

6-bromoimidazo[1,2-a]pyridine-3-carboxylic acid

Description:
6-Bromoimidazo[1,2-a]pyridine-3-carboxylic acid is a heterocyclic compound characterized by its imidazo and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 6-position of the imidazo ring enhances its reactivity and potential for substitution reactions. The carboxylic acid functional group at the 3-position provides acidic properties, allowing for hydrogen bonding and interactions with other molecules, which can be significant in biological systems or when used as a building block in organic synthesis. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its structural features may also influence its solubility, stability, and overall reactivity, making it a subject of interest in various chemical research fields. As with many heterocycles, the electronic properties imparted by the nitrogen atoms in the rings can affect its behavior in chemical reactions and interactions with other compounds.
Formula:C8H5BrN2O2
InChI:InChI=1/C8H5BrN2O2/c9-5-1-2-7-10-3-6(8(12)13)11(7)4-5/h1-4H,(H,12,13)
InChI key:SDKJLYHPCBMDAD-UHFFFAOYSA-N
SMILES:c1cc2ncc(C(=O)O)n2cc1Br
Synonyms:
  • Imidazo[1,2-A]Pyridine-3-Carboxylic Acid, 6-Bromo-
  • 6-Bromoimidazo[1,2-a]pyridine-3-carboxylicacid
Found 5 products.