CymitQuimica logo

CAS 944906-48-3

:

3-Bromo-6-chloroimidazo[1,2-a]pyrimidine

Description:
3-Bromo-6-chloroimidazo[1,2-a]pyrimidine is a heterocyclic compound characterized by its fused imidazole and pyrimidine rings, which contribute to its biological activity and chemical properties. The presence of bromine and chlorine substituents enhances its reactivity and potential for forming various derivatives. This compound typically exhibits moderate to high solubility in polar organic solvents, which is common for halogenated heterocycles. Its structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also display interesting electronic properties due to the presence of halogens, which can influence its reactivity and stability. Additionally, 3-Bromo-6-chloroimidazo[1,2-a]pyrimidine may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in organic synthesis. Overall, its unique structural features and substituents contribute to its significance in both research and application in chemical and pharmaceutical fields.
Formula:C6H3BrClN3
InChI:InChI=1S/C6H3BrClN3/c7-5-2-10-6-9-1-4(8)3-11(5)6/h1-3H
InChI key:ZNNVAIVBZLXARY-UHFFFAOYSA-N
SMILES:C1=C(N2C=C(C=NC2=N1)Cl)Br
Found 4 products.