CAS 945381-62-4

7-amino-5-fluoro-indolin-2-one

Description:

7-Amino-5-fluoro-indolin-2-one is a chemical compound characterized by its indolinone structure, which features a fused bicyclic system containing both a benzene and a pyrrole ring. The presence of an amino group at the 7-position and a fluorine atom at the 5-position contributes to its unique reactivity and potential biological activity. This compound is often studied for its applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its molecular structure suggests it may exhibit properties such as fluorescence, which can be useful in various analytical applications. Additionally, the presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it a candidate for drug development. The compound's CAS number, 945381-62-4, allows for precise identification in chemical databases and literature. Overall, 7-amino-5-fluoro-indolin-2-one represents a significant interest in the field of organic and medicinal chemistry due to its structural features and potential therapeutic applications.

Formula: C₈H₇FN₂O

InChI: InChI=1/C8H7FN2O/c9-5-1-4-2-7(12)11-8(4)6(10)3-5/h1,3H,2,10H2,(H,11,12)

SMILES: c1c2CC(=Nc2c(cc1F)N)O

Synonyms:

• 2H-indol-2-one, 7-amino-5-fluoro-1,3-dihydro-
• 7-Amino-5-fluoro-1,3-dihydro-2H-indol-2-one

7-Amino-5-fluoroindolin-2-one

CAS: 945381-62-4

Formula: C₈H₇FN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 166.1524

Ref: IN-DA00H60I

7-Amino-5-fluoroindolin-2-one

CAS: 945381-62-4

7-Amino-5-fluoroindolin-2-one

Purity: 95%

Molecular weight: 166.15g/mol

Ref: 54-PC201382

7-Amino-5-fluoroindolin-2-one

CAS: 945381-62-4

Formula: C₈H₇FN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 166.155

Ref: 10-F233258

7-Amino-5-fluoro-1,3-dihydroindol-2-one

CAS: 945381-62-4

7-Amino-5-fluoro-1,3-dihydroindol-2-one is a compound that can be used as a research chemical. It has been shown to react with various other compounds in the laboratory and may have potential uses as a versatile building block or useful intermediate. 7-Amino-5-fluoro-1,3-dihydroindol-2-one is also known for its high quality and speciality chemical status.

Formula: C₈H₇FN₂O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 166.15 g/mol

Ref: 3D-FA104789