CAS 945381-62-4
:7-amino-5-fluoro-indolin-2-one
Description:
7-Amino-5-fluoro-indolin-2-one is a chemical compound characterized by its indolinone structure, which features a fused bicyclic system containing both a benzene and a pyrrole ring. The presence of an amino group at the 7-position and a fluorine atom at the 5-position contributes to its unique reactivity and potential biological activity. This compound is often studied for its applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its molecular structure suggests it may exhibit properties such as fluorescence, which can be useful in various analytical applications. Additionally, the presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it a candidate for drug development. The compound's CAS number, 945381-62-4, allows for precise identification in chemical databases and literature. Overall, 7-amino-5-fluoro-indolin-2-one represents a significant interest in the field of organic and medicinal chemistry due to its structural features and potential therapeutic applications.
Formula:C8H7FN2O
InChI:InChI=1/C8H7FN2O/c9-5-1-4-2-7(12)11-8(4)6(10)3-5/h1,3H,2,10H2,(H,11,12)
SMILES:c1c2CC(=Nc2c(cc1F)N)O
Synonyms:- 2H-indol-2-one, 7-amino-5-fluoro-1,3-dihydro-
- 7-Amino-5-fluoro-1,3-dihydro-2H-indol-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7-Amino-5-fluoroindolin-2-one
CAS:7-Amino-5-fluoroindolin-2-oneFormula:C8H7FN2OPurity:95%Color and Shape:SolidMolecular weight:166.152387-Amino-5-fluoroindolin-2-one
CAS:Formula:C8H7FN2OPurity:95%Color and Shape:SolidMolecular weight:166.15247-Amino-5-fluoroindolin-2-one
CAS:Formula:C8H7FN2OPurity:95%Color and Shape:SolidMolecular weight:166.1557-Amino-5-fluoro-1,3-dihydroindol-2-one
CAS:7-Amino-5-fluoro-1,3-dihydroindol-2-one is a compound that can be used as a research chemical. It has been shown to react with various other compounds in the laboratory and may have potential uses as a versatile building block or useful intermediate. 7-Amino-5-fluoro-1,3-dihydroindol-2-one is also known for its high quality and speciality chemical status.
Formula:C8H7FN2OPurity:Min. 95%Color and Shape:PowderMolecular weight:166.15 g/mol7-Amino-5-fluoroindolin-2-one
CAS:7-Amino-5-fluoroindolin-2-oneFormula:C8H7FN2OPurity:95%Molecular weight:166.15




