CymitQuimica logo

CAS 94545-16-1

:

1,1'-butane-1,4-diylbis(1H-indole)

Description:
1,1'-Butane-1,4-diylbis(1H-indole), identified by its CAS number 94545-16-1, is an organic compound characterized by its unique structure, which features a butane backbone connecting two indole moieties. Indole is a bicyclic compound known for its aromatic properties, contributing to the compound's stability and potential reactivity. This substance is likely to exhibit properties typical of indole derivatives, such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry and materials science. The presence of the butane linker may influence the compound's conformation and interactions, affecting its physical and chemical properties. Additionally, compounds like this can participate in various chemical reactions, including electrophilic substitutions due to the electron-rich nature of the indole rings. Overall, 1,1'-butane-1,4-diylbis(1H-indole) represents a class of compounds that may have applications in pharmaceuticals, organic synthesis, and research into indole-based materials.
Formula:C20H20N2
InChI:InChI=1/C20H20N2/c1-3-9-19-17(7-1)11-15-21(19)13-5-6-14-22-16-12-18-8-2-4-10-20(18)22/h1-4,7-12,15-16H,5-6,13-14H2
Synonyms:
  • Butane, 1,4-di(1-indolyl)-
  • 1-[4-(1H-Indol-1-yl)butyl]-1H-indole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.