CymitQuimica logo

CAS 945666-87-5

:

4-Chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl acetate

Description:
4-Chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl acetate is a chemical compound characterized by its unique bicyclic structure, which incorporates a pyridine ring fused to a cyclopentane moiety. This compound features a chloro substituent at the 4-position and an acetate group at the 7-position, contributing to its reactivity and potential biological activity. The presence of the chloro group can influence the compound's electronic properties and solubility, while the acetate moiety may enhance its lipophilicity, affecting its pharmacokinetics. Typically, such compounds are of interest in medicinal chemistry due to their potential as therapeutic agents, particularly in the development of drugs targeting neurological or psychiatric disorders. The molecular structure suggests that it may exhibit specific interactions with biological targets, making it a candidate for further research in drug development. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions, such as pH and temperature.
Formula:C10H10ClNO2
InChI:InChI=1/C10H10ClNO2/c1-6(13)14-9-3-2-7-8(11)4-5-12-10(7)9/h4-5,9H,2-3H2,1H3
InChI key:MNKSKFGPLLEKNZ-UHFFFAOYSA-N
SMILES:CC(=O)OC1CCc2c(ccnc12)Cl
Synonyms:
  • 4-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl acetate ISO 9001:2015 REACH
  • 5H-Cyclopenta[b]pyridin-7-ol, 4-chloro-6,7-dihydro-, 7-acetate
  • 4-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl acetate
Found 2 products.