
CAS 945771-74-4
:BNC-105
Description:
BNC-105, with the CAS number 945771-74-4, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its potential therapeutic applications. It is classified as a small molecule and is primarily investigated for its role as an anti-cancer agent. The compound is known to exhibit properties that may inhibit tumor growth and promote apoptosis in cancer cells. BNC-105 functions through mechanisms that involve the modulation of cellular pathways, potentially affecting angiogenesis and cell proliferation. Its solubility, stability, and bioavailability are critical factors that influence its efficacy and application in clinical settings. As with many investigational drugs, ongoing research is essential to fully elucidate its pharmacokinetics, pharmacodynamics, and safety profile. The development of BNC-105 reflects the broader trend in drug discovery aimed at targeting specific molecular pathways in cancer therapy, highlighting the importance of precision medicine in oncology.
Formula:C20H20O7
InChI:InChI=1S/C20H20O7/c1-10-16(12-6-7-13(23-2)18(22)19(12)27-10)17(21)11-8-14(24-3)20(26-5)15(9-11)25-4/h6-9,22H,1-5H3
InChI key:RADMJHVVIZTENA-UHFFFAOYSA-N
SMILES:CC1=C(C2=C(O1)C(=C(C=C2)OC)O)C(=O)C3=CC(=C(C(=C3)OC)OC)OC
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
BNC105
CAS:BNC105 is a tubulin polymerization inhibitor. It has potent antiproliferative and tumor vascular disrupting properties.Formula:C20H20O7Purity:96.57%Color and Shape:SolidMolecular weight:372.37BNC105
CAS:BNC105 is an experimental vascular-disrupting agent, which is a synthetic small molecule with a focus on antitumor activity. BNC105 originates from a careful chemical synthesis process tailored to disrupt the formation of new blood vessels, known as angiogenesis, within tumors. Its primary mode of action involves targeting the tubulin within the endothelial cells that line the blood vessels, leading to rapid disassembly of microtubules. This disruption of the cytoskeleton results in the collapse of the tumor vasculature, effectively cutting off the blood supply to the tumor and thereby causing tumor hypoxia and necrosis.
Formula:C20H20O7Purity:Min. 95%Molecular weight:372.37 g/mol




