CymitQuimica logo

CAS 945840-69-7

:

1H-Pyrrolo[2,3-c]pyridine, 7-bromo-5-chloro-

Description:
1H-Pyrrolo[2,3-c]pyridine, 7-bromo-5-chloro- is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents at specific positions on the aromatic system enhances its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits moderate to high solubility in organic solvents, making it suitable for various synthetic reactions. Its molecular structure allows for potential interactions with biological targets, which is of interest in drug discovery. Additionally, the compound may display interesting electronic properties due to the halogen substituents, influencing its behavior in chemical reactions and interactions with other molecules. As with many halogenated compounds, it is essential to handle it with care, considering potential toxicity and environmental impact. Overall, 1H-Pyrrolo[2,3-c]pyridine, 7-bromo-5-chloro- represents a valuable scaffold in the development of new chemical entities.
Formula:C7H4BrClN2
InChI:InChI=1S/C7H4BrClN2/c8-7-6-4(1-2-10-6)3-5(9)11-7/h1-3,10H
InChI key:CUNQVEHLVCJZBL-UHFFFAOYSA-N
SMILES:C1=CNC2=C(N=C(C=C21)Cl)Br
Synonyms:
  • 7-Bromo-5-chloro-1H-pyrrolo[2,3-C]pyridine
Found 4 products.