CAS 94596-28-8
:Senkyunolide I
Description:
Senkyunolide I is a natural compound classified as a sesquiterpene lactone, primarily derived from the plant species *Ligusticum chuanxiong*, commonly known for its use in traditional medicine. This compound is characterized by its unique bicyclic structure, which contributes to its biological activity. Senkyunolide I exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and potential neuroprotective effects, making it of interest in medicinal chemistry and pharmacology. Its molecular formula typically includes carbon, hydrogen, and oxygen atoms, reflecting its organic nature. The compound's solubility is generally influenced by its hydrophobic characteristics, which can affect its bioavailability and interaction with biological systems. Research into Senkyunolide I continues to explore its mechanisms of action and potential therapeutic applications, particularly in the context of cardiovascular health and neurodegenerative diseases. As with many natural products, the extraction and purification processes are crucial for obtaining this compound in a form suitable for research and potential clinical use.
Formula:C12H16O4
InChI:InChI=1S/C12H16O4/c1-2-3-4-9-7-5-6-8(13)11(14)10(7)12(15)16-9/h4,8,11,13-14H,2-3,5-6H2,1H3/b9-4-/t8-,11+/m0/s1
InChI key:InChIKey=DQNGMIQSXNGHOA-JXQVETIVSA-N
SMILES:O[C@H]1C2=C(\C(=C\CCC)\OC2=O)CC[C@@H]1O
Synonyms:- 1(3H)-Isobenzofuranone,3-butylidene-4,5,6,7-tetrahydro-6,7-dihydroxy-, (3Z,6R,7R)-rel-
- 1(3H)-Isobenzofuranone,3-butylidene-4,5,6,7-tetrahydro-6,7-dihydroxy-, (3Z,6a,7b)-
- rel-(3Z,6R,7R)-3-Butylidene-4,5,6,7-tetrahydro-6,7-dihydroxy-1(3H)-isobenzofuranone
- Senkyunolide I
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Senkyunolide I
CAS:1. Senkyunolide I has neuroprotective effect, associated with its anti-oxidation and anti-apoptosis properties.Formula:C12H16O4Purity:99.73% - 99.88%Color and Shape:SolidMolecular weight:224.25Ref: TM-T5S2076
1mg46.00€5mg84.00€1mL*10mM (DMSO)94.00€10mg102.00€25mg152.00€50mg222.00€100mg340.00€200mg504.00€Senkyunolide I
CAS:LactoneFormula:C12H16O4Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:224.25Senkyunolide I
CAS:rel-(6R,7R,Z)-3-Butylidene-6,7-dihydroxy-4,5,6,7-tetrahydroisobenzofuran-1(3H)-oneFormula:C12H16O4Purity:99%Molecular weight:224.25Senkyunolide I
CAS:Senkyunolide I is a phthalide compound, which is primarily isolated from the plant Ligusticum chuanxiong, commonly known as Sichuan lovage. This compound is a crucial bioactive constituent of this traditional medicinal herb. Its primary mode of action involves the modulation of inflammatory pathways, where it exhibits notable anti-inflammatory and vasodilatory effects. Senkyunolide I achieves this by inhibiting the activity of certain enzymes and signaling molecules that are central to inflammatory processes.Formula:C12H16O4Purity:Min. 95%Molecular weight:224.25 g/mol







