CAS 946-13-4
:6-Methoxy-1,3-benzothiazole-2-carboxylic acid
Description:
6-Methoxy-1,3-benzothiazole-2-carboxylic acid, with the CAS number 946-13-4, is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features a methoxy group (-OCH3) at the 6-position and a carboxylic acid group (-COOH) at the 2-position of the benzothiazole moiety. It is typically a crystalline solid and is soluble in polar solvents due to the presence of the carboxylic acid group. The compound exhibits properties such as potential antimicrobial and antifungal activities, making it of interest in pharmaceutical and agricultural applications. Its molecular structure allows for various chemical reactions, including esterification and amidation, which can be utilized in synthetic chemistry. Additionally, the presence of the methoxy group can influence its reactivity and interaction with biological systems. Overall, 6-Methoxy-1,3-benzothiazole-2-carboxylic acid is a versatile compound with significant implications in research and industry.
Formula:C9H7NO3S
InChI:InChI=1/C9H7NO3S/c1-13-5-2-3-6-7(4-5)14-8(10-6)9(11)12/h2-4H,1H3,(H,11,12)
SMILES:COc1ccc2c(c1)sc(C(=O)O)n2
Synonyms:- 2-Benzothiazolecarboxylic Acid, 6-Methoxy-
- 6-Methoxybenzothiazole-2-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Methoxybenzo[d]thiazole-2-carboxylic acid
CAS:6-Methoxybenzo[d]thiazole-2-carboxylic acidFormula:C9H7NO3SPurity:≥95%Molecular weight:209.226-Methoxybenzothiazole-2-carboxylic acid
CAS:6-Methoxybenzothiazole-2-carboxylic acid is a synthetic sulfur compound that is used in the synthesis of benzothiazines. It is also an intermediate in the biosynthesis of thiocyanate, a natural product that has been shown to have anti-inflammatory properties. 6-Methoxybenzothiazole-2-carboxylic acid has been shown to be highly efficient as a luciferin, and can be used in the production of bioluminescence. 6-Methoxybenzothiazole-2-carboxylic acid belongs to the family of benzothiazines, which are benzoquinones with two fused rings. Benzothiazines are found in marine natural products such as luciferins and some other nature products.Formula:C9H7NO3SPurity:Min. 95%Color and Shape:PowderMolecular weight:209.22 g/mol6-Methoxy-benzothiazole-2-carboxylic acid
CAS:Formula:C9H7NO3SPurity:97%Color and Shape:SolidMolecular weight:209.222-Benzothiazolecarboxylic acid, 6-methoxy-
CAS:Formula:C9H7NO3SPurity:97%Color and Shape:SolidMolecular weight:209.2218




