CAS 946-65-6
:3-(trifluoromethylthio)benzoic acid
Description:
3-(Trifluoromethylthio)benzoic acid is an aromatic carboxylic acid characterized by the presence of a trifluoromethylthio group attached to the benzene ring at the meta position relative to the carboxylic acid functional group. This compound features a benzoic acid backbone, which contributes to its acidic properties, allowing it to donate protons in solution. The trifluoromethylthio group enhances the compound's lipophilicity and can influence its reactivity and interaction with biological systems. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of fluorine atoms often imparts unique electronic properties, making this compound of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, the trifluoromethylthio moiety can enhance the compound's stability and resistance to metabolic degradation. Safety data should be consulted for handling and potential hazards, as the trifluoromethyl group can contribute to toxicity and environmental persistence.
Formula:C8H4F3O2S
InChI:InChI=1/C8H5F3O2S/c9-8(10,11)14-6-3-1-2-5(4-6)7(12)13/h1-4H,(H,12,13)/p-1
SMILES:c1cc(cc(c1)SC(F)(F)F)C(=O)[O-]
Synonyms:- 3-[(Trifluoromethyl)Sulfanyl]Benzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(Trifluoromethylthio)benzoic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H5F3O2SPurity:97%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:222.183-(Trifluoromethylthio)benzoic acid
CAS:3-(Trifluoromethylthio)benzoic acidFormula:C8H5F3O2SPurity:98%Color and Shape:Solid-PowderMolecular weight:222.18433-((Trifluoromethyl)thio)benzoic acid
CAS:Formula:C8H5F3O2SPurity:98%Color and Shape:SolidMolecular weight:222.18433-(Trifluoromethylthio)benzoic acid
CAS:Formula:C8H5F3O2SPurity:97.0%Color and Shape:Solid, White powderMolecular weight:222.18




