CAS 946002-10-4
:(5-fluoropyridin-2-yl)boronic acid
Description:
(5-Fluoropyridin-2-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that has a fluorine substituent. This compound typically exhibits a white to off-white solid appearance and is soluble in polar solvents such as water and alcohols, which is a common trait of boronic acids due to their ability to form hydrogen bonds. The presence of the fluorine atom can influence the electronic properties of the pyridine ring, potentially enhancing its reactivity in various chemical reactions, including Suzuki coupling reactions, which are widely used in organic synthesis for forming carbon-carbon bonds. Additionally, boronic acids are known for their ability to form reversible complexes with diols, making them useful in various applications, including drug development and materials science. The compound's unique structure and reactivity profile make it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals.
Formula:C5H5BFNO2
InChI:InChI=1/C5H5BFNO2/c7-4-1-2-5(6(9)10)8-3-4/h1-3,9-10H
SMILES:c1cc(B(O)O)ncc1F
Synonyms:- boronic acid, B-(5-fluoro-2-pyridinyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Fluoropyridin-2-ylboronic acid
CAS:Formula:C5H5BFNO2Purity:98%Color and Shape:SolidMolecular weight:140.9081Ref: IN-DA003MRS
1g156.00€5g303.00€10g606.00€25gTo inquire100gTo inquire50mg62.00€100mg69.00€250mg101.00€500mg124.00€5-Fluoropyridine-2-boronic acid
CAS:5-Fluoropyridine-2-boronic acidFormula:C5H5BFNO2Purity:90%Color and Shape: white solidMolecular weight:140.91g/mol5-Fluoropyridine-2-boronic acid
CAS:Formula:C5H5BFNO2Purity:98%Color and Shape:SolidMolecular weight:140.91Ref: 10-F065597
1g148.00€5g393.00€10g717.00€25gTo inquire50mg42.00€100mg65.00€250mg86.00€500mg114.00€5-Fluoropyridine-2-boronic acid
CAS:Please enquire for more information about 5-Fluoropyridine-2-boronic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C5H5BFNO2Purity:Min. 95%Molecular weight:140.91 g/mol



