CAS 946002-10-4

(5-fluoropyridin-2-yl)boronic acid

Description:

(5-Fluoropyridin-2-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that has a fluorine substituent. This compound typically exhibits a white to off-white solid appearance and is soluble in polar solvents such as water and alcohols, which is a common trait of boronic acids due to their ability to form hydrogen bonds. The presence of the fluorine atom can influence the electronic properties of the pyridine ring, potentially enhancing its reactivity in various chemical reactions, including Suzuki coupling reactions, which are widely used in organic synthesis for forming carbon-carbon bonds. Additionally, boronic acids are known for their ability to form reversible complexes with diols, making them useful in various applications, including drug development and materials science. The compound's unique structure and reactivity profile make it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals.

Formula: C₅H₅BFNO₂

InChI: InChI=1/C5H5BFNO2/c7-4-1-2-5(6(9)10)8-3-4/h1-3,9-10H

SMILES: c1cc(B(O)O)ncc1F

Synonyms:

• boronic acid, B-(5-fluoro-2-pyridinyl)-

5-Fluoropyridine-2-boronic acid

CAS: 946002-10-4

5-Fluoropyridine-2-boronic acid

Formula: C₅H₅BFNO₂

Purity: 90%

Color and Shape: Solid

Molecular weight: 140.9081

Ref: 54-PC1428

5-Fluoropyridin-2-ylboronic acid

CAS: 946002-10-4

5-Fluoropyridin-2-ylboronic acid

Formula: C₅H₅BFNO₂

Purity: 98%

Molecular weight: 140.91

Ref: IN-DG159162

5-Fluoropyridin-2-ylboronic acid

CAS: 946002-10-4

Formula: C₅H₅BFNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 140.9081

Ref: IN-DA003MRS

5-Fluoropyridine-2-boronic acid

CAS: 946002-10-4

Formula: C₅H₅BFNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 140.91

Ref: 10-F065597

5-Fluoropyridine-2-boronic acid

CAS: 946002-10-4

Please enquire for more information about 5-Fluoropyridine-2-boronic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₅H₅BFNO₂

Purity: Min. 95%

Molecular weight: 140.91 g/mol

Ref: 3D-FF46218