CAS 94610-82-9
:2-Fluoro-4-methoxybenzonitrile
Description:
2-Fluoro-4-methoxybenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a fluorine atom at the second position and a methoxy group at the fourth position, along with a nitrile functional group (-C≡N) attached to the benzene. This compound typically appears as a colorless to pale yellow solid or liquid, depending on its physical state at room temperature. It is known for its moderate polarity due to the presence of the nitrile and methoxy groups, which can influence its solubility in various organic solvents. The fluorine atom contributes to its reactivity and can affect the compound's electronic properties, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, 2-Fluoro-4-methoxybenzonitrile may exhibit specific biological activities, which can be explored in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H6FNO
InChI:InChI=1S/C8H6FNO/c1-11-7-3-2-6(5-10)8(9)4-7/h2-4H,1H3
InChI key:InChIKey=HWKUZTFIZATJPM-UHFFFAOYSA-N
SMILES:O(C)C1=CC(F)=C(C#N)C=C1
Synonyms:- 3-Fluoro-4-cyanoanisole
- Benzonitrile, 2-fluoro-4-methoxy-
- 2-Fluoro-4-methoxybenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-fluoro-4-cyano anisole
CAS:3-fluoro-4-cyano anisoleFormula:C8H6FNOPurity:98%Molecular weight:151.142-Fluoro-4-methoxybenzonitrile
CAS:2-Fluoro-4-methoxybenzonitrileFormula:C8H6FNOPurity:98%Color and Shape:Solid-PowderMolecular weight:151.137742-Fluoro-4-methoxybenzonitrile
CAS:Formula:C8H6FNOPurity:98%Color and Shape:SolidMolecular weight:151.13772-Fluoro-4-methoxybenzonitrile
CAS:2-Fluoro-4-methoxybenzonitrile is a tetracyclic molecule with two electron deficient rings. It has intramolecular coupling, yielding four stereoisomers that show different biological activities. 2-Fluoro-4-methoxybenzonitrile is an electron deficient compound that can be synthesized by reacting dioxane with amines. It also reacts with alcohols to form ethers. This heteroaromatic compound has electron withdrawing groups that make it less stable than other heteroaromatic compounds and more reactive. 2-Fluoro-4-methoxybenzonitrile can be used in the Buchwald reaction to produce aryl chlorides from alkyl halides and aryl bromides.
Purity:Min. 95%2-Fluoro-4-methoxybenzonitrile
CAS:Formula:C8H6FNOPurity:98%Color and Shape:SolidMolecular weight:151.14




