CAS 946126-94-9

Benzoic acid, 2-fluoro-3-nitro-, methyl ester

Description:

Benzoic acid, 2-fluoro-3-nitro-, methyl ester, identified by the CAS number 946126-94-9, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety modified by a methyl ester group and two substituents: a fluoro group and a nitro group. The presence of the fluoro group typically enhances the compound's reactivity and can influence its physical properties, such as solubility and boiling point. The nitro group is known for its electron-withdrawing properties, which can affect the acidity and reactivity of the compound in various chemical reactions. As a methyl ester, it is likely to be more lipophilic compared to its corresponding acid, which may impact its biological activity and potential applications in pharmaceuticals or agrochemicals. Overall, this compound's unique combination of functional groups makes it of interest in synthetic organic chemistry and potentially in the development of new materials or bioactive compounds.

Formula: C₈H₆FNO₄

InChI: InChI=1S/C8H6FNO4/c1-14-8(11)5-3-2-4-6(7(5)9)10(12)13/h2-4H,1H3

InChI key: InChIKey=VEKYKLDXYNUERO-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(F)C(N(=O)=O)=CC=C1

Synonyms:

• 2-Fluoro-3-nitrobenzoic acid methyl ester
• Methyl 2-fluoro-3-nitrobenzoate
• Benzoic acid, 2-fluoro-3-nitro-, methyl ester

Methyl 2-fluoro-3-nitrobenzoate

CAS: 946126-94-9

Methyl 2-fluoro-3-nitrobenzoate

Formula: C₈H₆FNO₄

Purity: 99%

Color and Shape: Solid

Molecular weight: 199.13594

Ref: 54-PC49297

Methyl 2-Fluoro-3-nitrobenzoate

CAS: 946126-94-9

Formula: C₈H₆FNO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 199.1359

Ref: IN-DA00H5S1

Methyl 2-Fluoro-3-nitrobenzoate

CAS: 946126-94-9

Formula: C₈H₆FNO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 199.137

Ref: 10-F066784

Methyl 2-fluoro-3-nitrobenzoate

CAS: 946126-94-9

Methyl 2-fluoro-3-nitrobenzoate

Formula: C₈H₆FNO₄

Purity: 98%

Molecular weight: 199.14

Ref: IN-DG168190

Methyl 2-fluoro-3-nitrobenzoate

Controlled Product

CAS: 946126-94-9

Applications Methyl 2-fluoro-3-nitrobenzoate

Formula: C₈H₆FNO₄

Color and Shape: Neat

Molecular weight: 199.14

Ref: TR-M305423