
CAS 946524-24-9
:Ascaroside C6
Description:
Ascaroside C6, identified by its CAS number 946524-24-9, is a chemical compound that belongs to a class of molecules known as ascarosides, which are derived from the nematode Caenorhabditis elegans. This compound is characterized by its unique structure, which typically includes a sugar moiety linked to a fatty acid or a long-chain hydrocarbon. Ascarosides play significant roles in interspecies communication and signaling within nematodes, influencing behaviors such as mating and aggregation. The presence of specific functional groups in Ascaroside C6 contributes to its biological activity, making it a subject of interest in studies related to nematode biology and potential applications in pest control. Additionally, its stability and solubility in various solvents can vary, impacting its utility in research and practical applications. Overall, Ascaroside C6 exemplifies the intricate relationship between chemical structure and biological function in natural products.
Formula:C12H22O5
InChI:InChI=1S/C12H22O5/c1-7(13)4-5-8(2)16-12-11(15)6-10(14)9(3)17-12/h8-12,14-15H,4-6H2,1-3H3/t8-,9+,10-,11-,12-/m1/s1
InChI key:InChIKey=KDIFLHQRDPSWHT-IYKVGLELSA-N
SMILES:O([C@@H](CCC(C)=O)C)[C@H]1[C@H](O)C[C@@H](O)[C@H](C)O1
Synonyms:- 2-Hexanone, 5-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-, (5R)-
- Ascaroside C6
- (5R)-5-[(3,6-Dideoxy-α-L-arabino-hexopyranosyl)oxy]-2-hexanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ascr#2
CAS:Ascr#2 (asc-C6-MK) is a glycoside analog in Cryptobacterium hidradii that promotes dauer formation and can be used to detect population density.Formula:C12H22O5Purity:≥98% - ≥98%Color and Shape:SolidMolecular weight:246.3Ascaroside C6
CAS:Ascaroside C6 is a potent inhibitor of tumor growth and a promising anticancer agent. It is a vitamin analog that has been isolated from Chinese urine and has been shown to induce apoptosis in cancer cells. Ascaroside C6 inhibits the activity of kinases, which are proteins that play an important role in cell division and proliferation. This inhibition leads to the suppression of cancer cell growth and the induction of programmed cell death. Ascaroside C6 has potential as a therapeutic agent for various types of cancer due to its strong anticancer activity and ability to inhibit kinase activity.
Formula:C12H22O5Purity:Min. 95%Molecular weight:246.3 g/mol



