CAS 946524-36-3
:(9Z)-N-(2-Hydroxyethyl-1,1,2,2-d4)-9-octadecenamide
Description:
(9Z)-N-(2-Hydroxyethyl-1,1,2,2-d4)-9-octadecenamide, with CAS number 946524-36-3, is a synthetic compound characterized by its long-chain fatty acid structure, specifically an 18-carbon unsaturated fatty acid with a cis double bond at the ninth position. The presence of the hydroxyethyl group indicates that it has a hydroxyl functional group, which contributes to its solubility and reactivity. The deuterated form (1,1,2,2-d4) suggests that it contains deuterium isotopes, which can be useful in various analytical techniques, including NMR spectroscopy, to trace metabolic pathways or study molecular interactions. This compound may exhibit amphiphilic properties due to its hydrophobic fatty acid tail and hydrophilic hydroxyethyl head, making it potentially useful in applications such as drug delivery systems, emulsifiers, or surfactants. Its unique structural features and isotopic labeling can also facilitate research in biochemistry and pharmacology, particularly in understanding lipid metabolism and membrane dynamics.
Formula:C20H35D4NO2
InChI:InChI=1S/C20H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)21-18-19-22/h9-10,22H,2-8,11-19H2,1H3,(H,21,23)/b10-9-/i18D2,19D2
InChI key:InChIKey=BOWVQLFMWHZBEF-QAFBOUAWSA-N
SMILES:C(CCCCC/C=C\CCCCCCCC)CC(NC(C(O)([2H])[2H])([2H])[2H])=O
Synonyms:- (9Z)-N-(2-Hydroxyethyl-1,1,2,2-d4)-9-octadecenamide
- 9-Octadecenamide, N-(2-hydroxyethyl-1,1,2,2-d4)-, (9Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Oleoylethanolamide-d4
CAS:Oleoylethanolamide-d4 is the deuterated form of Oleoylethanolamide. This compound serves as a high-affinity endogenous PPAR-α agonist and is utilized in research related to obesity and atherosclerosis.Formula:C20H39NO2Color and Shape:SolidMolecular weight:329.55N-Oleoylethanolamide-d4
CAS:Controlled ProductFormula:C20D4H35NO2Color and Shape:NeatMolecular weight:329.554

